C33H34F3N3O4S2 — CID 87913505
N-[(2S,3R)-2-benzyl-3-hydroxy-1-(N-methylsulfonylanilino)-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]sulfanylbenzamide (PubChem CID 87913505) has the molecular formula C33H34F3N3O4S2 and a molecular weight of 657.78 g/mol. Its IUPAC name is N-[(2S,3R)-2-benzyl-3-hydroxy-1-(N-methylsulfonylanilino)-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]sulfanylbenzamide.
| Compound Name | N-[(2S,3R)-2-benzyl-3-hydroxy-1-(N-methylsulfonylanilino)-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 87913505 |
| Molecular Formula | C33H34F3N3O4S2 |
| Molecular Weight | 657.78 g/mol |
| Exact Mass | 657.19 |
| IUPAC Name | N-[(2S,3R)-2-benzyl-3-hydroxy-1-(N-methylsulfonylanilino)-4-[[3-(trifluoromethyl)phenyl]methylamino]butyl]sulfanylbenzamide |
| SMILES | CS(=O)(=O)N(c1ccccc1)C(SNC(=O)c1ccccc1)[C@@H](Cc1ccccc1)[C@@H](O)CNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H34F3N3O4S2/c1-45(42,43)39(28-18-9-4-10-19-28)32(44-38-31(41)26-15-7-3-8-16-26)29(21-24-12-5-2-6-13-24)30(40)23-37-22-25-14-11-17-27(20-25)33(34,35)36/h2-20,29-30,32,37,40H,21-23H2,1H3,(H,38,41)/t29-,30-,32?/m0/s1 |
| InChIKey | JIKLBMBQNMXCMG-XNVRKLAPSA-N |
| XLogP | 5.89 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|