C22H47NO2 — CID 87914026
2-(3,5,5-trimethylhexoxy)-N-[2-(3,5,5-trimethylhexoxy)ethyl]ethanamine (PubChem CID 87914026) has the molecular formula C22H47NO2 and a molecular weight of 357.62 g/mol. Its IUPAC name is 2-(3,5,5-trimethylhexoxy)-N-[2-(3,5,5-trimethylhexoxy)ethyl]ethanamine.
| Compound Name | 2-(3,5,5-trimethylhexoxy)-N-[2-(3,5,5-trimethylhexoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 87914026 |
| Molecular Formula | C22H47NO2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 357.36 |
| IUPAC Name | 2-(3,5,5-trimethylhexoxy)-N-[2-(3,5,5-trimethylhexoxy)ethyl]ethanamine |
| SMILES | CC(CCOCCNCCOCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C22H47NO2/c1-19(17-21(3,4)5)9-13-24-15-11-23-12-16-25-14-10-20(2)18-22(6,7)8/h19-20,23H,9-18H2,1-8H3 |
| InChIKey | PEWBHPHQRWHIFJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|