C30H63NO4 — CID 87914102
2-[4-(3,5,5-trimethylhexoxy)butoxy]-N-[2-[4-(3,5,5-trimethylhexoxy)butoxy]ethyl]ethanamine (PubChem CID 87914102) has the molecular formula C30H63NO4 and a molecular weight of 501.84 g/mol. Its IUPAC name is 2-[4-(3,5,5-trimethylhexoxy)butoxy]-N-[2-[4-(3,5,5-trimethylhexoxy)butoxy]ethyl]ethanamine.
| Compound Name | 2-[4-(3,5,5-trimethylhexoxy)butoxy]-N-[2-[4-(3,5,5-trimethylhexoxy)butoxy]ethyl]ethanamine |
|---|---|
| PubChem CID | 87914102 |
| Molecular Formula | C30H63NO4 |
| Molecular Weight | 501.84 g/mol |
| Exact Mass | 501.48 |
| IUPAC Name | 2-[4-(3,5,5-trimethylhexoxy)butoxy]-N-[2-[4-(3,5,5-trimethylhexoxy)butoxy]ethyl]ethanamine |
| SMILES | CC(CCOCCCCOCCNCCOCCCCOCCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C30H63NO4/c1-27(25-29(3,4)5)13-21-32-17-9-11-19-34-23-15-31-16-24-35-20-12-10-18-33-22-14-28(2)26-30(6,7)8/h27-28,31H,9-26H2,1-8H3 |
| InChIKey | YHECCYNCMGXSNA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.84 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|