C20H28O2 — CID 87914348
(2E,4E,6E,8E,10E,12E,14E)-6,11,15-trimethylheptadeca-2,4,6,8,10,12,14-heptaene-1,16-diol (PubChem CID 87914348) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E,14E)-6,11,15-trimethylheptadeca-2,4,6,8,10,12,14-heptaene-1,16-diol.
| Compound Name | (2E,4E,6E,8E,10E,12E,14E)-6,11,15-trimethylheptadeca-2,4,6,8,10,12,14-heptaene-1,16-diol |
|---|---|
| PubChem CID | 87914348 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E,14E)-6,11,15-trimethylheptadeca-2,4,6,8,10,12,14-heptaene-1,16-diol |
| SMILES | CC(/C=C/C=C/CO)=C\C=C\C=C(C)\C=C\C=C(/C)C(C)O |
| InChI | InChI=1S/C20H28O2/c1-17(11-6-5-9-16-21)12-7-8-13-18(2)14-10-15-19(3)20(4)22/h5-15,20-22H,16H2,1-4H3/b8-7+,9-5+,11-6+,14-10+,17-12+,18-13+,19-15+ |
| InChIKey | HUVVCVVVMKPFCX-IMYJMIMKSA-N |
| XLogP | 4.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|