About 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium)
2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) (PubChem CID 87914505) has the molecular formula C7H11Br2NO7P2+2
and a molecular weight of 442.92 g/mol. Its IUPAC name is 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium).
Molecular Properties
| Compound Name | 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) |
| PubChem CID | 87914505 |
| Molecular Formula | C7H11Br2NO7P2+2 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 440.84 |
| IUPAC Name | 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) |
| SMILES | CNc1cc(Br)c(O)c(Br)c1.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C7H7Br2NO.2HO3P/c1-10-4-2-5(8)7(11)6(9)3-4;2*1-4(2)3/h2-3,10-11H,1H3;2*(H-,1,2,3)/p+2 |
| InChIKey | JDKCGMWMVADNMW-UHFFFAOYSA-P |
| XLogP | 2.22 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium)?
The IUPAC name of 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) (CID 87914505) is 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium).
What is the SMILES notation for 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium)?
The canonical SMILES for 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) is CNc1cc(Br)c(O)c(Br)c1.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium)?
The InChIKey is JDKCGMWMVADNMW-UHFFFAOYSA-P. The full InChI is InChI=1S/C7H7Br2NO.2HO3P/c1-10-4-2-5(8)7(11)6(9)3-4;2*1-4(2)3/h2-3,10-11H,1H3;2*(H-,1,2,3)/p+2.
What are the key properties of 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium)?
2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) has a molecular weight of 442.92 g/mol, XLogP of 2.22, 1 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-(methylamino)phenol;bis(dihydroxy(oxo)phosphanium) is sourced from PubChem (CID 87914505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).