About barium(2+);4H-chromene;oxygen(2-)
barium(2+);4H-chromene;oxygen(2-) (PubChem CID 87914530) has the molecular formula C9H8BaO2
and a molecular weight of 285.49 g/mol. Its IUPAC name is barium(2+);4H-chromene;oxygen(2-).
Molecular Properties
| Compound Name | barium(2+);4H-chromene;oxygen(2-) |
| PubChem CID | 87914530 |
| Molecular Formula | C9H8BaO2 |
| Molecular Weight | 285.49 g/mol |
| Exact Mass | 285.96 |
| IUPAC Name | barium(2+);4H-chromene;oxygen(2-) |
| SMILES | C1=COc2ccccc2C1.[Ba+2].[O-2] |
| InChI | InChI=1S/C9H8O.Ba.O/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-4,6-7H,5H2;;/q;+2;-2 |
| InChIKey | FDSSEDBYNPBYDG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 37.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze barium(2+);4H-chromene;oxygen(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);4H-chromene;oxygen(2-)?
The IUPAC name of barium(2+);4H-chromene;oxygen(2-) (CID 87914530) is barium(2+);4H-chromene;oxygen(2-).
What is the SMILES notation for barium(2+);4H-chromene;oxygen(2-)?
The canonical SMILES for barium(2+);4H-chromene;oxygen(2-) is C1=COc2ccccc2C1.[Ba+2].[O-2].
What is the InChIKey of barium(2+);4H-chromene;oxygen(2-)?
The InChIKey is FDSSEDBYNPBYDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.Ba.O/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-4,6-7H,5H2;;/q;+2;-2.
What are the key properties of barium(2+);4H-chromene;oxygen(2-)?
barium(2+);4H-chromene;oxygen(2-) has a molecular weight of 285.49 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);4H-chromene;oxygen(2-) is sourced from PubChem (CID 87914530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).