About tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate
tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate (PubChem CID 87915022) has the molecular formula C31H27F6N3O2
and a molecular weight of 587.56 g/mol. Its IUPAC name is tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate |
| PubChem CID | 87915022 |
| Molecular Formula | C31H27F6N3O2 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)ccc1N(C(=O)OC(C)(C)C)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1C |
| InChI | InChI=1S/C31H27F6N3O2/c1-18-26(16-14-24(38-18)20-6-10-22(11-7-20)30(32,33)34)40(28(41)42-29(3,4)5)27-17-15-25(39-19(27)2)21-8-12-23(13-9-21)31(35,36)37/h6-17H,1-5H3 |
| InChIKey | UBVUOCNRFLKMST-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate?
The IUPAC name of tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate (CID 87915022) is tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate.
What is the SMILES notation for tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate?
The canonical SMILES for tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate is Cc1nc(-c2ccc(C(F)(F)F)cc2)ccc1N(C(=O)OC(C)(C)C)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1C.
What is the InChIKey of tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate?
The InChIKey is UBVUOCNRFLKMST-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H27F6N3O2/c1-18-26(16-14-24(38-18)20-6-10-22(11-7-20)30(32,33)34)40(28(41)42-29(3,4)5)27-17-15-25(39-19(27)2)21-8-12-23(13-9-21)31(35,36)37/h6-17H,1-5H3.
What are the key properties of tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate?
tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate has a molecular weight of 587.56 g/mol, XLogP of 9.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N,N-bis[2-methyl-6-[4-(trifluoromethyl)phenyl]-3-pyridinyl]carbamate is sourced from PubChem (CID 87915022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).