C14H16Cl2N2 — CID 87915156
(4aR,8aS)-7-(5,6-dichloro-3-pyridinyl)-1,2,3,4,4a,5,6,8a-octahydroisoquinoline (PubChem CID 87915156) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is (4aR,8aS)-7-(5,6-dichloro-3-pyridinyl)-1,2,3,4,4a,5,6,8a-octahydroisoquinoline.
| Compound Name | (4aR,8aS)-7-(5,6-dichloro-3-pyridinyl)-1,2,3,4,4a,5,6,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 87915156 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (4aR,8aS)-7-(5,6-dichloro-3-pyridinyl)-1,2,3,4,4a,5,6,8a-octahydroisoquinoline |
| SMILES | Clc1cc(C2=C[C@H]3CNCC[C@H]3CC2)cnc1Cl |
| InChI | InChI=1S/C14H16Cl2N2/c15-13-6-12(8-18-14(13)16)10-2-1-9-3-4-17-7-11(9)5-10/h5-6,8-9,11,17H,1-4,7H2/t9-,11+/m1/s1 |
| InChIKey | LZPFMJQAYOAPGG-KOLCDFICSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|