C13H15BrN2 — CID 87915320
(3aR,6aS)-5-(6-bromo-5-methyl-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 87915320) has the molecular formula C13H15BrN2 and a molecular weight of 279.18 g/mol. Its IUPAC name is (3aR,6aS)-5-(6-bromo-5-methyl-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-5-(6-bromo-5-methyl-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 87915320 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (3aR,6aS)-5-(6-bromo-5-methyl-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | Cc1cc(C2=C[C@H]3CNC[C@H]3C2)cnc1Br |
| InChI | InChI=1S/C13H15BrN2/c1-8-2-10(7-16-13(8)14)9-3-11-5-15-6-12(11)4-9/h2-3,7,11-12,15H,4-6H2,1H3/t11-,12+/m0/s1 |
| InChIKey | AOLDWBZHCSAUHO-NWDGAFQWSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|