About (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene
(1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene (PubChem CID 87915461) has the molecular formula C11H10Cl2N2
and a molecular weight of 241.12 g/mol. Its IUPAC name is (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene.
Molecular Properties
| Compound Name | (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene |
| PubChem CID | 87915461 |
| Molecular Formula | C11H10Cl2N2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene |
| SMILES | Clc1cc(C2=C[C@H]3CN[C@H]3C2)cnc1Cl |
| InChI | InChI=1S/C11H10Cl2N2/c12-9-2-7(4-15-11(9)13)6-1-8-5-14-10(8)3-6/h1-2,4,8,10,14H,3,5H2/t8-,10-/m0/s1 |
| InChIKey | WMGIHEORDCCCJM-WPRPVWTQSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene?
The IUPAC name of (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene (CID 87915461) is (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene.
What is the SMILES notation for (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene?
The canonical SMILES for (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene is Clc1cc(C2=C[C@H]3CN[C@H]3C2)cnc1Cl.
What is the InChIKey of (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene?
The InChIKey is WMGIHEORDCCCJM-WPRPVWTQSA-N. The full InChI is InChI=1S/C11H10Cl2N2/c12-9-2-7(4-15-11(9)13)6-1-8-5-14-10(8)3-6/h1-2,4,8,10,14H,3,5H2/t8-,10-/m0/s1.
What are the key properties of (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene?
(1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene has a molecular weight of 241.12 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-3-(5,6-dichloro-3-pyridinyl)-6-azabicyclo[3.2.0]hept-2-ene is sourced from PubChem (CID 87915461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).