C12H12Cl2N2 — CID 87915525
(3aS,6aS)-4-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 87915525) has the molecular formula C12H12Cl2N2 and a molecular weight of 255.15 g/mol. Its IUPAC name is (3aS,6aS)-4-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aS)-4-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 87915525 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | (3aS,6aS)-4-(5,6-dichloro-3-pyridinyl)-1,2,3,3a,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | Clc1cc(C2=CC[C@@H]3CNC[C@H]23)cnc1Cl |
| InChI | InChI=1S/C12H12Cl2N2/c13-11-3-8(5-16-12(11)14)9-2-1-7-4-15-6-10(7)9/h2-3,5,7,10,15H,1,4,6H2/t7-,10+/m1/s1 |
| InChIKey | HSDYIYATFXJCHY-XCBNKYQSSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|