C14H17BrN2 — CID 87915567
(4aR,7aS)-6-(6-bromo-5-methyl-3-pyridinyl)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine (PubChem CID 87915567) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is (4aR,7aS)-6-(6-bromo-5-methyl-3-pyridinyl)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine.
| Compound Name | (4aR,7aS)-6-(6-bromo-5-methyl-3-pyridinyl)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 87915567 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (4aR,7aS)-6-(6-bromo-5-methyl-3-pyridinyl)-2,3,4,4a,7,7a-hexahydro-1H-cyclopenta[b]pyridine |
| SMILES | Cc1cc(C2=C[C@H]3CCCN[C@H]3C2)cnc1Br |
| InChI | InChI=1S/C14H17BrN2/c1-9-5-12(8-17-14(9)15)11-6-10-3-2-4-16-13(10)7-11/h5-6,8,10,13,16H,2-4,7H2,1H3/t10-,13+/m1/s1 |
| InChIKey | QABDJAVRCQREPH-MFKMUULPSA-N |
| XLogP | 3.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|