C35H34F6N2O6 — CID 87915737
cyclopropyl 1-[1-(4-methoxyphenoxy)-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 87915737) has the molecular formula C35H34F6N2O6 and a molecular weight of 692.65 g/mol. Its IUPAC name is cyclopropyl 1-[1-(4-methoxyphenoxy)-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | cyclopropyl 1-[1-(4-methoxyphenoxy)-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 87915737 |
| Molecular Formula | C35H34F6N2O6 |
| Molecular Weight | 692.65 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | cyclopropyl 1-[1-(4-methoxyphenoxy)-2-[(2,2,2-trifluoroacetyl)amino]ethyl]-4-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COc1ccc(OC(CNC(=O)C(F)(F)F)N2CCC(c3ccc(CCCOc4c(F)ccc(F)c4F)cc3)=C(C(=O)OC3CC3)C2)cc1 |
| InChI | InChI=1S/C35H34F6N2O6/c1-46-23-8-10-24(11-9-23)48-30(19-42-34(45)35(39,40)41)43-17-16-26(27(20-43)33(44)49-25-12-13-25)22-6-4-21(5-7-22)3-2-18-47-32-29(37)15-14-28(36)31(32)38/h4-11,14-15,25,30H,2-3,12-13,16-20H2,1H3,(H,42,45) |
| InChIKey | DWEKPCHRIDWQRU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|