C13H19N3O — CID 879158
(1R)-1,3,3-trimethyl-2,4-dihydroisoquinoline-1-carbohydrazide (PubChem CID 879158) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (1R)-1,3,3-trimethyl-2,4-dihydroisoquinoline-1-carbohydrazide.
| Compound Name | (1R)-1,3,3-trimethyl-2,4-dihydroisoquinoline-1-carbohydrazide |
|---|---|
| PubChem CID | 879158 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (1R)-1,3,3-trimethyl-2,4-dihydroisoquinoline-1-carbohydrazide |
| SMILES | CC1(C)Cc2ccccc2[C@](C)(C(=O)NN)N1 |
| InChI | InChI=1S/C13H19N3O/c1-12(2)8-9-6-4-5-7-10(9)13(3,16-12)11(17)15-14/h4-7,16H,8,14H2,1-3H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | ZVAVWQSAEPTEJN-CYBMUJFWSA-N |
| XLogP | 0.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|