C22H19N7OS — CID 87916504
1-cyano-2-propan-2-yl-1-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]guanidine (PubChem CID 87916504) has the molecular formula C22H19N7OS and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-cyano-2-propan-2-yl-1-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]guanidine.
| Compound Name | 1-cyano-2-propan-2-yl-1-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 87916504 |
| Molecular Formula | C22H19N7OS |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-cyano-2-propan-2-yl-1-[3-[3-(thiophene-2-carbonyl)pyrazolo[1,5-a]pyrimidin-7-yl]phenyl]guanidine |
| SMILES | CC(C)/N=C(\N)N(C#N)c1cccc(-c2ccnc3c(C(=O)c4cccs4)cnn23)c1 |
| InChI | InChI=1S/C22H19N7OS/c1-14(2)27-22(24)28(13-23)16-6-3-5-15(11-16)18-8-9-25-21-17(12-26-29(18)21)20(30)19-7-4-10-31-19/h3-12,14H,1-2H3,(H2,24,27) |
| InChIKey | IOSQRGZFRNDYAW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 112.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|