C12H4F6O2 — CID 87916814
4-(2,4-difluoro-3-hydroxyphenyl)-2,3,5,6-tetrafluorophenol (PubChem CID 87916814) has the molecular formula C12H4F6O2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 4-(2,4-difluoro-3-hydroxyphenyl)-2,3,5,6-tetrafluorophenol.
| Compound Name | 4-(2,4-difluoro-3-hydroxyphenyl)-2,3,5,6-tetrafluorophenol |
|---|---|
| PubChem CID | 87916814 |
| Molecular Formula | C12H4F6O2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 4-(2,4-difluoro-3-hydroxyphenyl)-2,3,5,6-tetrafluorophenol |
| SMILES | Oc1c(F)ccc(-c2c(F)c(F)c(O)c(F)c2F)c1F |
| InChI | InChI=1S/C12H4F6O2/c13-4-2-1-3(6(14)11(4)19)5-7(15)9(17)12(20)10(18)8(5)16/h1-2,19-20H |
| InChIKey | FNOCHURFMFSXKL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|