C14HF9O2 — CID 87916834
(1,2,3,5,6,7,9,10-octafluoro-8-hydroxyphenanthren-4-yl) hypofluorite (PubChem CID 87916834) has the molecular formula C14HF9O2 and a molecular weight of 372.14 g/mol. Its IUPAC name is (1,2,3,5,6,7,9,10-octafluoro-8-hydroxyphenanthren-4-yl) hypofluorite.
| Compound Name | (1,2,3,5,6,7,9,10-octafluoro-8-hydroxyphenanthren-4-yl) hypofluorite |
|---|---|
| PubChem CID | 87916834 |
| Molecular Formula | C14HF9O2 |
| Molecular Weight | 372.14 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | (1,2,3,5,6,7,9,10-octafluoro-8-hydroxyphenanthren-4-yl) hypofluorite |
| SMILES | Oc1c(F)c(F)c(F)c2c1c(F)c(F)c1c(F)c(F)c(F)c(OF)c12 |
| InChI | InChI=1S/C14HF9O2/c15-5-1-2-3(7(17)10(20)12(22)14(2)25-23)6(16)8(18)4(1)13(24)11(21)9(5)19/h24H |
| InChIKey | CLNWKNYEFWQBTP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.14 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|