C14HCl9O2 — CID 87916843
(2,3,4,5,6,7,8,10-octachloro-1-hydroxyphenanthren-9-yl) hypochlorite (PubChem CID 87916843) has the molecular formula C14HCl9O2 and a molecular weight of 520.24 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,10-octachloro-1-hydroxyphenanthren-9-yl) hypochlorite.
| Compound Name | (2,3,4,5,6,7,8,10-octachloro-1-hydroxyphenanthren-9-yl) hypochlorite |
|---|---|
| PubChem CID | 87916843 |
| Molecular Formula | C14HCl9O2 |
| Molecular Weight | 520.24 g/mol |
| Exact Mass | 515.72 |
| IUPAC Name | (2,3,4,5,6,7,8,10-octachloro-1-hydroxyphenanthren-9-yl) hypochlorite |
| SMILES | Oc1c(Cl)c(Cl)c(Cl)c2c1c(Cl)c(OCl)c1c(Cl)c(Cl)c(Cl)c(Cl)c12 |
| InChI | InChI=1S/C14HCl9O2/c15-5-1-2-4(7(17)10(20)9(19)6(2)16)14(25-23)8(18)3(1)13(24)12(22)11(5)21/h24H |
| InChIKey | QEFZHDCUGMBSQH-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.24 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|