C14H3F9O2 — CID 87916942
1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracene-1,2-diol (PubChem CID 87916942) has the molecular formula C14H3F9O2 and a molecular weight of 374.16 g/mol. Its IUPAC name is 1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracene-1,2-diol.
| Compound Name | 1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracene-1,2-diol |
|---|---|
| PubChem CID | 87916942 |
| Molecular Formula | C14H3F9O2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 1,3,4,5,6,7,8,9,10-nonafluoro-2H-anthracene-1,2-diol |
| SMILES | OC1C(F)=C(F)c2c(c(F)c3c(F)c(F)c(F)c(F)c3c2F)C1(O)F |
| InChI | InChI=1S/C14H3F9O2/c15-5-1-2(8(18)11(21)10(20)7(1)17)6(16)4-3(5)9(19)12(22)13(24)14(4,23)25/h13,24-25H |
| InChIKey | UKVYWPAHUDLDEN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|