About methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide
methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide (PubChem CID 87916986) has the molecular formula C11H14IO2Zn-
and a molecular weight of 370.53 g/mol. Its IUPAC name is methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide.
Molecular Properties
| Compound Name | methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide |
| PubChem CID | 87916986 |
| Molecular Formula | C11H14IO2Zn- |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide |
| SMILES | I.[CH2-]Cc1cccc(CC(=O)OC)c1.[Zn] |
| InChI | InChI=1S/C11H13O2.HI.Zn/c1-3-9-5-4-6-10(7-9)8-11(12)13-2;;/h4-7H,1,3,8H2,2H3;1H;/q-1;; |
| InChIKey | FQBDXEFMMICTPP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide?
The IUPAC name of methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide (CID 87916986) is methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide.
What is the SMILES notation for methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide?
The canonical SMILES for methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide is I.[CH2-]Cc1cccc(CC(=O)OC)c1.[Zn].
What is the InChIKey of methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide?
The InChIKey is FQBDXEFMMICTPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O2.HI.Zn/c1-3-9-5-4-6-10(7-9)8-11(12)13-2;;/h4-7H,1,3,8H2,2H3;1H;/q-1;;.
What are the key properties of methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide?
methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide has a molecular weight of 370.53 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-ethylphenyl)acetate;zinc;hydroiodide is sourced from PubChem (CID 87916986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).