About sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol
sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol (PubChem CID 87917141) has the molecular formula C12H17NaO6S
and a molecular weight of 312.32 g/mol. Its IUPAC name is sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol.
Molecular Properties
| Compound Name | sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol |
| PubChem CID | 87917141 |
| Molecular Formula | C12H17NaO6S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol |
| SMILES | C=CCOCC(O)CO.O=S(=O)([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C6H6O3S.C6H12O3.Na/c7-10(8,9)6-4-2-1-3-5-6;1-2-3-9-5-6(8)4-7;/h1-5H,(H,7,8,9);2,6-8H,1,3-5H2;/q;;+1/p-1 |
| InChIKey | SYAZMZUEPFMPHJ-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol?
The IUPAC name of sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol (CID 87917141) is sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol.
What is the SMILES notation for sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol?
The canonical SMILES for sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol is C=CCOCC(O)CO.O=S(=O)([O-])c1ccccc1.[Na+].
What is the InChIKey of sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol?
The InChIKey is SYAZMZUEPFMPHJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O3S.C6H12O3.Na/c7-10(8,9)6-4-2-1-3-5-6;1-2-3-9-5-6(8)4-7;/h1-5H,(H,7,8,9);2,6-8H,1,3-5H2;/q;;+1/p-1.
What are the key properties of sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol?
sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol has a molecular weight of 312.32 g/mol, XLogP of -2.86, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzenesulfonate;3-prop-2-enoxypropane-1,2-diol is sourced from PubChem (CID 87917141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).