C28H35F3N2O5S — CID 87917239
(2R,3S)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4-sulfonylbutanamide;trifluoromethylbenzene (PubChem CID 87917239) has the molecular formula C28H35F3N2O5S and a molecular weight of 568.66 g/mol. Its IUPAC name is (2R,3S)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4-sulfonylbutanamide;trifluoromethylbenzene.
| Compound Name | (2R,3S)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4-sulfonylbutanamide;trifluoromethylbenzene |
|---|---|
| PubChem CID | 87917239 |
| Molecular Formula | C28H35F3N2O5S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | (2R,3S)-2,3-dihydroxy-N-[(1R)-6-[(4-methylpiperidin-1-yl)methyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-4-sulfonylbutanamide;trifluoromethylbenzene |
| SMILES | CC1CCN(Cc2ccc3c(c2)CCC[C@H]3NC(=O)[C@H](O)[C@H](O)C=S(=O)=O)CC1.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C21H30N2O5S.C7H5F3/c1-14-7-9-23(10-8-14)12-15-5-6-17-16(11-15)3-2-4-18(17)22-21(26)20(25)19(24)13-29(27)28;8-7(9,10)6-4-2-1-3-5-6/h5-6,11,13-14,18-20,24-25H,2-4,7-10,12H2,1H3,(H,22,26);1-5H/t18-,19-,20-;/m1./s1 |
| InChIKey | XFLCJZWNFRYOGX-DEXIKXDTSA-N |
| XLogP | 3.52 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|