C23H25F3N2O8S — CID 87917773
(3,5-dimethoxyphenyl) 7-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid (PubChem CID 87917773) has the molecular formula C23H25F3N2O8S and a molecular weight of 546.52 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) 7-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid.
| Compound Name | (3,5-dimethoxyphenyl) 7-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87917773 |
| Molecular Formula | C23H25F3N2O8S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | (3,5-dimethoxyphenyl) 7-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(OC)cc(OS(=O)(=O)c2cc(N3CCN[C@@H](C)C3)c3occc3c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24N2O6S.C2HF3O2/c1-14-13-23(6-5-22-14)20-12-19(8-15-4-7-28-21(15)20)30(24,25)29-18-10-16(26-2)9-17(11-18)27-3;3-2(4,5)1(6)7/h4,7-12,14,22H,5-6,13H2,1-3H3;(H,6,7)/t14-;/m0./s1 |
| InChIKey | YOKYFEPWCMDEAW-UQKRIMTDSA-N |
| XLogP | 3.65 |
| TPSA | 127.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|