C23H23F2N3O3 — CID 87917906
(2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-3-oxo-N-[(3S,6S)-7-oxo-3-phenyl-1,2,3,6-tetrahydroazepin-6-yl]butanamide (PubChem CID 87917906) has the molecular formula C23H23F2N3O3 and a molecular weight of 427.45 g/mol. Its IUPAC name is (2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-3-oxo-N-[(3S,6S)-7-oxo-3-phenyl-1,2,3,6-tetrahydroazepin-6-yl]butanamide.
| Compound Name | (2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-3-oxo-N-[(3S,6S)-7-oxo-3-phenyl-1,2,3,6-tetrahydroazepin-6-yl]butanamide |
|---|---|
| PubChem CID | 87917906 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-3-oxo-N-[(3S,6S)-7-oxo-3-phenyl-1,2,3,6-tetrahydroazepin-6-yl]butanamide |
| SMILES | C[C@@](N)(C(=O)Cc1cc(F)cc(F)c1)C(=O)N[C@H]1C=C[C@@H](c2ccccc2)CNC1=O |
| InChI | InChI=1S/C23H23F2N3O3/c1-23(26,20(29)11-14-9-17(24)12-18(25)10-14)22(31)28-19-8-7-16(13-27-21(19)30)15-5-3-2-4-6-15/h2-10,12,16,19H,11,13,26H2,1H3,(H,27,30)(H,28,31)/t16-,19+,23-/m1/s1 |
| InChIKey | YAEYKJNMYBXXOU-BVZALQNUSA-N |
| XLogP | 1.75 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|