C24H25F2N3O3 — CID 87917926
(2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-N-[(3S,6S)-1-methyl-7-oxo-3-phenyl-3,6-dihydro-2H-azepin-6-yl]-3-oxobutanamide (PubChem CID 87917926) has the molecular formula C24H25F2N3O3 and a molecular weight of 441.48 g/mol. Its IUPAC name is (2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-N-[(3S,6S)-1-methyl-7-oxo-3-phenyl-3,6-dihydro-2H-azepin-6-yl]-3-oxobutanamide.
| Compound Name | (2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-N-[(3S,6S)-1-methyl-7-oxo-3-phenyl-3,6-dihydro-2H-azepin-6-yl]-3-oxobutanamide |
|---|---|
| PubChem CID | 87917926 |
| Molecular Formula | C24H25F2N3O3 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (2R)-2-amino-4-(3,5-difluorophenyl)-2-methyl-N-[(3S,6S)-1-methyl-7-oxo-3-phenyl-3,6-dihydro-2H-azepin-6-yl]-3-oxobutanamide |
| SMILES | CN1C[C@H](c2ccccc2)C=C[C@H](NC(=O)[C@](C)(N)C(=O)Cc2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C24H25F2N3O3/c1-24(27,21(30)12-15-10-18(25)13-19(26)11-15)23(32)28-20-9-8-17(14-29(2)22(20)31)16-6-4-3-5-7-16/h3-11,13,17,20H,12,14,27H2,1-2H3,(H,28,32)/t17-,20+,24-/m1/s1 |
| InChIKey | XPUIUMRCHIRRDI-VWQFJMCTSA-N |
| XLogP | 2.09 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|