C11H6F10O4 — CID 87918193
3-(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)oxycarbonylbut-3-enoic acid (PubChem CID 87918193) has the molecular formula C11H6F10O4 and a molecular weight of 392.15 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)oxycarbonylbut-3-enoic acid.
| Compound Name | 3-(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)oxycarbonylbut-3-enoic acid |
|---|---|
| PubChem CID | 87918193 |
| Molecular Formula | C11H6F10O4 |
| Molecular Weight | 392.15 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl)oxycarbonylbut-3-enoic acid |
| SMILES | C=C(CC(=O)O)C(=O)OC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H6F10O4/c1-3(2-4(22)23)5(24)25-6-7(12,13)9(16,17)11(20,21)10(18,19)8(6,14)15/h6H,1-2H2,(H,22,23) |
| InChIKey | KKFMXSIKKKTPMG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|