C17H21FN2 — CID 87918226
5-[1-(4-fluorophenyl)ethylideneamino]-N,N,4-trimethylcyclohexa-1,5-dien-1-amine (PubChem CID 87918226) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-[1-(4-fluorophenyl)ethylideneamino]-N,N,4-trimethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 5-[1-(4-fluorophenyl)ethylideneamino]-N,N,4-trimethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 87918226 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 5-[1-(4-fluorophenyl)ethylideneamino]-N,N,4-trimethylcyclohexa-1,5-dien-1-amine |
| SMILES | C/C(=N\C1=CC(N(C)C)=CCC1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN2/c1-12-5-10-16(20(3)4)11-17(12)19-13(2)14-6-8-15(18)9-7-14/h6-12H,5H2,1-4H3/b19-13+ |
| InChIKey | FXPHGKHPEGAWCG-CPNJWEJPSA-N |
| XLogP | 4.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|