C9H6Cl6NiO3S — CID 87918340
1,9,10,11,12,12-hexachloro-4,6-dioxa-5λ4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide;nickel (PubChem CID 87918340) has the molecular formula C9H6Cl6NiO3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 1,9,10,11,12,12-hexachloro-4,6-dioxa-5λ4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide;nickel.
| Compound Name | 1,9,10,11,12,12-hexachloro-4,6-dioxa-5λ4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide;nickel |
|---|---|
| PubChem CID | 87918340 |
| Molecular Formula | C9H6Cl6NiO3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 461.75 |
| IUPAC Name | 1,9,10,11,12,12-hexachloro-4,6-dioxa-5λ4-thiatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide;nickel |
| SMILES | O=S1OCC2C(CO1)C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl.[Ni] |
| InChI | InChI=1S/C9H6Cl6O3S.Ni/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15;/h3-4H,1-2H2; |
| InChIKey | REGXFBJPHZACJI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|