C8H11F6O4P — CID 87919172
4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-hydroxy-1,3,2λ5-dioxaphosphocane 2-oxide (PubChem CID 87919172) has the molecular formula C8H11F6O4P and a molecular weight of 316.13 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-hydroxy-1,3,2λ5-dioxaphosphocane 2-oxide.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-hydroxy-1,3,2λ5-dioxaphosphocane 2-oxide |
|---|---|
| PubChem CID | 87919172 |
| Molecular Formula | C8H11F6O4P |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-hydroxy-1,3,2λ5-dioxaphosphocane 2-oxide |
| SMILES | O=P1(O)OCCCCC(C(C(F)(F)F)C(F)(F)F)O1 |
| InChI | InChI=1S/C8H11F6O4P/c9-7(10,11)6(8(12,13)14)5-3-1-2-4-17-19(15,16)18-5/h5-6H,1-4H2,(H,15,16) |
| InChIKey | IWWOBKHUENIKSQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|