C18H12Cl6N4O2 — CID 87919709
4-hydroxybenzamide;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 87919709) has the molecular formula C18H12Cl6N4O2 and a molecular weight of 529.04 g/mol. Its IUPAC name is 4-hydroxybenzamide;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 4-hydroxybenzamide;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 87919709 |
| Molecular Formula | C18H12Cl6N4O2 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 525.91 |
| IUPAC Name | 4-hydroxybenzamide;2-phenyl-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1nc(-c2ccccc2)nc(C(Cl)(Cl)Cl)n1.NC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H5Cl6N3.C7H7NO2/c12-10(13,14)8-18-7(6-4-2-1-3-5-6)19-9(20-8)11(15,16)17;8-7(10)5-1-3-6(9)4-2-5/h1-5H;1-4,9H,(H2,8,10) |
| InChIKey | CDEGQFIMJMCXLZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|