C32H35F3N2O7S — CID 87919715
[2-[1-benzyl-3-[[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]phenyl] trifluoromethanesulfonate (PubChem CID 87919715) has the molecular formula C32H35F3N2O7S and a molecular weight of 648.70 g/mol. Its IUPAC name is [2-[1-benzyl-3-[[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[1-benzyl-3-[[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87919715 |
| Molecular Formula | C32H35F3N2O7S |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | [2-[1-benzyl-3-[[4-(3-methoxypropyl)-3-oxo-1,4-benzoxazin-6-yl]methoxy]piperidin-4-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COCCCN1C(=O)COc2ccc(COC3CN(Cc4ccccc4)CCC3c3ccccc3OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C32H35F3N2O7S/c1-41-17-7-15-37-27-18-24(12-13-29(27)43-22-31(37)38)21-42-30-20-36(19-23-8-3-2-4-9-23)16-14-26(30)25-10-5-6-11-28(25)44-45(39,40)32(33,34)35/h2-6,8-13,18,26,30H,7,14-17,19-22H2,1H3 |
| InChIKey | ULQLWUINLNMMHF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|