About 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc
2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc (PubChem CID 87920625) has the molecular formula C8H10ClNO5SZn
and a molecular weight of 333.08 g/mol. Its IUPAC name is 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc.
Molecular Properties
| Compound Name | 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc |
| PubChem CID | 87920625 |
| Molecular Formula | C8H10ClNO5SZn |
| Molecular Weight | 333.08 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc |
| SMILES | NC(=O)CCl.O=S(=O)(O)c1ccccc1O.[Zn] |
| InChI | InChI=1S/C6H6O4S.C2H4ClNO.Zn/c7-5-3-1-2-4-6(5)11(8,9)10;3-1-2(4)5;/h1-4,7H,(H,8,9,10);1H2,(H2,4,5); |
| InChIKey | GSWSGMBDWFRMOX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.08 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc?
The IUPAC name of 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc (CID 87920625) is 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc.
What is the SMILES notation for 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc?
The canonical SMILES for 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc is NC(=O)CCl.O=S(=O)(O)c1ccccc1O.[Zn].
What is the InChIKey of 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc?
The InChIKey is GSWSGMBDWFRMOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4S.C2H4ClNO.Zn/c7-5-3-1-2-4-6(5)11(8,9)10;3-1-2(4)5;/h1-4,7H,(H,8,9,10);1H2,(H2,4,5);.
What are the key properties of 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc?
2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc has a molecular weight of 333.08 g/mol, XLogP of 0.35, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetamide;2-hydroxybenzenesulfonic acid;zinc is sourced from PubChem (CID 87920625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).