About 4,5-dichloro-6-(2,3-dimethylphenyl)triazine
4,5-dichloro-6-(2,3-dimethylphenyl)triazine (PubChem CID 87920683) has the molecular formula C11H9Cl2N3
and a molecular weight of 254.12 g/mol. Its IUPAC name is 4,5-dichloro-6-(2,3-dimethylphenyl)triazine.
Molecular Properties
| Compound Name | 4,5-dichloro-6-(2,3-dimethylphenyl)triazine |
| PubChem CID | 87920683 |
| Molecular Formula | C11H9Cl2N3 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 4,5-dichloro-6-(2,3-dimethylphenyl)triazine |
| SMILES | Cc1cccc(-c2nnnc(Cl)c2Cl)c1C |
| InChI | InChI=1S/C11H9Cl2N3/c1-6-4-3-5-8(7(6)2)10-9(12)11(13)15-16-14-10/h3-5H,1-2H3 |
| InChIKey | SBMTZIOVDAESTK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dichloro-6-(2,3-dimethylphenyl)triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-6-(2,3-dimethylphenyl)triazine?
The IUPAC name of 4,5-dichloro-6-(2,3-dimethylphenyl)triazine (CID 87920683) is 4,5-dichloro-6-(2,3-dimethylphenyl)triazine.
What is the SMILES notation for 4,5-dichloro-6-(2,3-dimethylphenyl)triazine?
The canonical SMILES for 4,5-dichloro-6-(2,3-dimethylphenyl)triazine is Cc1cccc(-c2nnnc(Cl)c2Cl)c1C.
What is the InChIKey of 4,5-dichloro-6-(2,3-dimethylphenyl)triazine?
The InChIKey is SBMTZIOVDAESTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N3/c1-6-4-3-5-8(7(6)2)10-9(12)11(13)15-16-14-10/h3-5H,1-2H3.
What are the key properties of 4,5-dichloro-6-(2,3-dimethylphenyl)triazine?
4,5-dichloro-6-(2,3-dimethylphenyl)triazine has a molecular weight of 254.12 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-6-(2,3-dimethylphenyl)triazine is sourced from PubChem (CID 87920683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).