C24H17F17O3S2 — CID 87920974
(2-methyl-1,1-diphenylpropyl)sulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 87920974) has the molecular formula C24H17F17O3S2 and a molecular weight of 740.50 g/mol. Its IUPAC name is (2-methyl-1,1-diphenylpropyl)sulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | (2-methyl-1,1-diphenylpropyl)sulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 87920974 |
| Molecular Formula | C24H17F17O3S2 |
| Molecular Weight | 740.50 g/mol |
| Exact Mass | 740.03 |
| IUPAC Name | (2-methyl-1,1-diphenylpropyl)sulfanyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | CC(C)C(SOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H17F17O3S2/c1-13(2)16(14-9-5-3-6-10-14,15-11-7-4-8-12-15)45-44-46(42,43)24(40,41)22(35,36)20(31,32)18(27,28)17(25,26)19(29,30)21(33,34)23(37,38)39/h3-13H,1-2H3 |
| InChIKey | ZIOVKNLUPCVPQT-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.50 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|