About tetrasulfanyl carbamate
tetrasulfanyl carbamate (PubChem CID 87921024) has the molecular formula CH3NO2S4
and a molecular weight of 189.31 g/mol. Its IUPAC name is tetrasulfanyl carbamate.
Molecular Properties
| Compound Name | tetrasulfanyl carbamate |
| PubChem CID | 87921024 |
| Molecular Formula | CH3NO2S4 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 188.90 |
| IUPAC Name | tetrasulfanyl carbamate |
| SMILES | NC(=O)OSSSS |
| InChI | InChI=1S/CH3NO2S4/c2-1(3)4-6-8-7-5/h5H,(H2,2,3) |
| InChIKey | OIFALSCCAMZFDX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tetrasulfanyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrasulfanyl carbamate?
The IUPAC name of tetrasulfanyl carbamate (CID 87921024) is tetrasulfanyl carbamate.
What is the SMILES notation for tetrasulfanyl carbamate?
The canonical SMILES for tetrasulfanyl carbamate is NC(=O)OSSSS.
What is the InChIKey of tetrasulfanyl carbamate?
The InChIKey is OIFALSCCAMZFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO2S4/c2-1(3)4-6-8-7-5/h5H,(H2,2,3).
What are the key properties of tetrasulfanyl carbamate?
tetrasulfanyl carbamate has a molecular weight of 189.31 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tetrasulfanyl carbamate is sourced from PubChem (CID 87921024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).