C5H12O4 — CID 87921477
(2S,3R)-2-(deuteriomethyl)butane-1,2,3,4-tetrol (PubChem CID 87921477) has the molecular formula C5H12O4 and a molecular weight of 137.15 g/mol. Its IUPAC name is (2S,3R)-2-(deuteriomethyl)butane-1,2,3,4-tetrol.
| Compound Name | (2S,3R)-2-(deuteriomethyl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 87921477 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (2S,3R)-2-(deuteriomethyl)butane-1,2,3,4-tetrol |
| SMILES | [2H]C[C@](O)(CO)[C@H](O)CO |
| InChI | InChI=1S/C5H12O4/c1-5(9,3-7)4(8)2-6/h4,6-9H,2-3H2,1H3/t4-,5+/m1/s1/i1D |
| InChIKey | HGVJFBSSLICXEM-IYAWRTBQSA-N |
| XLogP | -1.92 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |