C16H11F9I+ — CID 87922282
diphenyliodanium;1,1,1,2,2,3,3,4,4-nonafluorobutane (PubChem CID 87922282) has the molecular formula C16H11F9I+ and a molecular weight of 501.15 g/mol. Its IUPAC name is diphenyliodanium;1,1,1,2,2,3,3,4,4-nonafluorobutane.
| Compound Name | diphenyliodanium;1,1,1,2,2,3,3,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 87922282 |
| Molecular Formula | C16H11F9I+ |
| Molecular Weight | 501.15 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | diphenyliodanium;1,1,1,2,2,3,3,4,4-nonafluorobutane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.C4HF9/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;5-1(6)2(7,8)3(9,10)4(11,12)13/h1-10H;1H/q+1; |
| InChIKey | TZPDPYPMOSVWKK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|