C21H16F4N2O6S — CID 87922765
[14-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-13-oxa-5,14-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-2,4(9),5,7,10-pentaen-10-yl] trifluoromethanesulfonate (PubChem CID 87922765) has the molecular formula C21H16F4N2O6S and a molecular weight of 500.43 g/mol. Its IUPAC name is [14-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-13-oxa-5,14-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-2,4(9),5,7,10-pentaen-10-yl] trifluoromethanesulfonate.
| Compound Name | [14-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-13-oxa-5,14-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-2,4(9),5,7,10-pentaen-10-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87922765 |
| Molecular Formula | C21H16F4N2O6S |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | [14-[(4-fluorophenyl)methyl]-3-(methoxymethoxy)-13-oxa-5,14-diazatetracyclo[10.1.1.02,11.04,9]tetradeca-2,4(9),5,7,10-pentaen-10-yl] trifluoromethanesulfonate |
| SMILES | COCOc1c2c(c(OS(=O)(=O)C(F)(F)F)c3cccnc13)C1OC2N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16F4N2O6S/c1-30-10-31-18-15-14(19-27(20(15)32-19)9-11-4-6-12(22)7-5-11)17(13-3-2-8-26-16(13)18)33-34(28,29)21(23,24)25/h2-8,19-20H,9-10H2,1H3 |
| InChIKey | MFQROGPROUBKJF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|