About but-1-ene-1,1-dithiol
but-1-ene-1,1-dithiol (PubChem CID 87922875) has the molecular formula C4H8S2
and a molecular weight of 120.24 g/mol. Its IUPAC name is but-1-ene-1,1-dithiol.
Molecular Properties
| Compound Name | but-1-ene-1,1-dithiol |
| PubChem CID | 87922875 |
| Molecular Formula | C4H8S2 |
| Molecular Weight | 120.24 g/mol |
| Exact Mass | 120.01 |
| IUPAC Name | but-1-ene-1,1-dithiol |
| SMILES | CCC=C(S)S |
| InChI | InChI=1S/C4H8S2/c1-2-3-4(5)6/h3,5-6H,2H2,1H3 |
| InChIKey | GQERLXBSOIOHMF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene-1,1-dithiol?
The IUPAC name of but-1-ene-1,1-dithiol (CID 87922875) is but-1-ene-1,1-dithiol.
What is the SMILES notation for but-1-ene-1,1-dithiol?
The canonical SMILES for but-1-ene-1,1-dithiol is CCC=C(S)S.
What is the InChIKey of but-1-ene-1,1-dithiol?
The InChIKey is GQERLXBSOIOHMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8S2/c1-2-3-4(5)6/h3,5-6H,2H2,1H3.
What are the key properties of but-1-ene-1,1-dithiol?
but-1-ene-1,1-dithiol has a molecular weight of 120.24 g/mol, XLogP of 2.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene-1,1-dithiol is sourced from PubChem (CID 87922875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).