About 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate
2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate (PubChem CID 87923325) has the molecular formula C21H29O6P
and a molecular weight of 408.43 g/mol. Its IUPAC name is 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate.
Molecular Properties
| Compound Name | 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate |
| PubChem CID | 87923325 |
| Molecular Formula | C21H29O6P |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate |
| SMILES | COCCOOC(=O)C(C)(P=O)C1(C(=O)c2c(C)cc(C)cc2C)CCCC1 |
| InChI | InChI=1S/C21H29O6P/c1-14-12-15(2)17(16(3)13-14)18(22)21(8-6-7-9-21)20(4,28-24)19(23)27-26-11-10-25-5/h12-13H,6-11H2,1-5H3 |
| InChIKey | PYQARGBWWOVEFK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate?
The IUPAC name of 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate (CID 87923325) is 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate.
What is the SMILES notation for 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate?
The canonical SMILES for 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate is COCCOOC(=O)C(C)(P=O)C1(C(=O)c2c(C)cc(C)cc2C)CCCC1.
What is the InChIKey of 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate?
The InChIKey is PYQARGBWWOVEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29O6P/c1-14-12-15(2)17(16(3)13-14)18(22)21(8-6-7-9-21)20(4,28-24)19(23)27-26-11-10-25-5/h12-13H,6-11H2,1-5H3.
What are the key properties of 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate?
2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate has a molecular weight of 408.43 g/mol, XLogP of 4.53, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 2-phosphoroso-2-[1-(2,4,6-trimethylbenzoyl)cyclopentyl]propaneperoxoate is sourced from PubChem (CID 87923325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).