C44H20F8N4 — CID 87923894
2,3,5,7,8,10,12,20-octafluoro-13,15,17,18-tetraphenylporphyrin (PubChem CID 87923894) has the molecular formula C44H20F8N4 and a molecular weight of 756.66 g/mol. Its IUPAC name is 2,3,5,7,8,10,12,20-octafluoro-13,15,17,18-tetraphenylporphyrin.
| Compound Name | 2,3,5,7,8,10,12,20-octafluoro-13,15,17,18-tetraphenylporphyrin |
|---|---|
| PubChem CID | 87923894 |
| Molecular Formula | C44H20F8N4 |
| Molecular Weight | 756.66 g/mol |
| Exact Mass | 756.16 |
| IUPAC Name | 2,3,5,7,8,10,12,20-octafluoro-13,15,17,18-tetraphenylporphyrin |
| SMILES | FC1=C(F)/C2=C(\F)C3=N/C(=C(/F)C4=N/C(=C(/c5ccccc5)C5=N/C(=C(/F)C1=N2)C(F)=C5c1ccccc1)C(c1ccccc1)=C4c1ccccc1)C(F)=C3F |
| InChI | InChI=1S/C44H20F8N4/c45-29-27(23-17-9-3-10-18-23)38-28(24-19-11-4-12-20-24)37-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)39(53-37)34(50)41-30(46)31(47)43(55-41)36(52)44-33(49)32(48)42(56-44)35(51)40(29)54-38/h1-20H/b37-28-,38-28-,39-34+,40-35+,41-34+,42-35+,43-36+,44-36+ |
| InChIKey | FBRCYSGJGKKHBG-BJZMEIEDSA-N |
| XLogP | 12.07 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.66 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|