C14H17NO5 — CID 87923930
methyl 3-oxo-2-(3-oxo-4,5,6,7-tetrahydro-1H-isoindole-2-carbonyl)butanoate (PubChem CID 87923930) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl 3-oxo-2-(3-oxo-4,5,6,7-tetrahydro-1H-isoindole-2-carbonyl)butanoate.
| Compound Name | methyl 3-oxo-2-(3-oxo-4,5,6,7-tetrahydro-1H-isoindole-2-carbonyl)butanoate |
|---|---|
| PubChem CID | 87923930 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl 3-oxo-2-(3-oxo-4,5,6,7-tetrahydro-1H-isoindole-2-carbonyl)butanoate |
| SMILES | COC(=O)C(C(C)=O)C(=O)N1CC2=C(CCCC2)C1=O |
| InChI | InChI=1S/C14H17NO5/c1-8(16)11(14(19)20-2)13(18)15-7-9-5-3-4-6-10(9)12(15)17/h11H,3-7H2,1-2H3 |
| InChIKey | ILYLNGXLDVHSNI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|