About ethanethioamide;2-sulfanylideneacetamide
ethanethioamide;2-sulfanylideneacetamide (PubChem CID 87924059) has the molecular formula C4H8N2OS2
and a molecular weight of 164.26 g/mol. Its IUPAC name is ethanethioamide;2-sulfanylideneacetamide.
Molecular Properties
| Compound Name | ethanethioamide;2-sulfanylideneacetamide |
| PubChem CID | 87924059 |
| Molecular Formula | C4H8N2OS2 |
| Molecular Weight | 164.26 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | ethanethioamide;2-sulfanylideneacetamide |
| SMILES | CC(N)=S.NC(=O)C=S |
| InChI | InChI=1S/C2H3NOS.C2H5NS/c3-2(4)1-5;1-2(3)4/h1H,(H2,3,4);1H3,(H2,3,4) |
| InChIKey | BMECJGWPZRIFEY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethanethioamide;2-sulfanylideneacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethioamide;2-sulfanylideneacetamide?
The IUPAC name of ethanethioamide;2-sulfanylideneacetamide (CID 87924059) is ethanethioamide;2-sulfanylideneacetamide.
What is the SMILES notation for ethanethioamide;2-sulfanylideneacetamide?
The canonical SMILES for ethanethioamide;2-sulfanylideneacetamide is CC(N)=S.NC(=O)C=S.
What is the InChIKey of ethanethioamide;2-sulfanylideneacetamide?
The InChIKey is BMECJGWPZRIFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NOS.C2H5NS/c3-2(4)1-5;1-2(3)4/h1H,(H2,3,4);1H3,(H2,3,4).
What are the key properties of ethanethioamide;2-sulfanylideneacetamide?
ethanethioamide;2-sulfanylideneacetamide has a molecular weight of 164.26 g/mol, XLogP of -0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethioamide;2-sulfanylideneacetamide is sourced from PubChem (CID 87924059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).