C23H23ClFNO5S — CID 87924183
2-[4-chloro-2-(2,3-dihydro-1-benzofuran-5-yloxy)-5-fluorophenyl]ethanamine;4-methylbenzenesulfonic acid (PubChem CID 87924183) has the molecular formula C23H23ClFNO5S and a molecular weight of 479.96 g/mol. Its IUPAC name is 2-[4-chloro-2-(2,3-dihydro-1-benzofuran-5-yloxy)-5-fluorophenyl]ethanamine;4-methylbenzenesulfonic acid.
| Compound Name | 2-[4-chloro-2-(2,3-dihydro-1-benzofuran-5-yloxy)-5-fluorophenyl]ethanamine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87924183 |
| Molecular Formula | C23H23ClFNO5S |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | 2-[4-chloro-2-(2,3-dihydro-1-benzofuran-5-yloxy)-5-fluorophenyl]ethanamine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NCCc1cc(F)c(Cl)cc1Oc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H15ClFNO2.C7H8O3S/c17-13-9-16(10(3-5-19)8-14(13)18)21-12-1-2-15-11(7-12)4-6-20-15;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,7-9H,3-6,19H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | BRSVKMPRAWMRLE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|