C22H30F4N6O3 — CID 87924201
(2S,4S)-1-tert-butyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)-2-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxylate (PubChem CID 87924201) has the molecular formula C22H30F4N6O3 and a molecular weight of 502.51 g/mol. Its IUPAC name is (2S,4S)-1-tert-butyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)-2-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxylate.
| Compound Name | (2S,4S)-1-tert-butyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)-2-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 87924201 |
| Molecular Formula | C22H30F4N6O3 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | (2S,4S)-1-tert-butyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)-2-(3,3,4,4-tetrafluoropyrrolidine-1-carbonyl)pyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(C)(C)[N+]1(C(=O)[O-])C[C@@H](N2CCN(c3ncccn3)CC2)C[C@H]1C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C22H30F4N6O3/c1-20(2,3)32(19(34)35)12-15(29-7-9-30(10-8-29)18-27-5-4-6-28-18)11-16(32)17(33)31-13-21(23,24)22(25,26)14-31/h4-6,15-16H,7-14H2,1-3H3/t15-,16-,32?/m0/s1 |
| InChIKey | IEULYGFFRZGLTD-KSKSGFSYSA-N |
| XLogP | 0.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|