C17H22F4N2O — CID 87924366
1-methyl-4-[7-(1,1,2,2-tetrafluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine (PubChem CID 87924366) has the molecular formula C17H22F4N2O and a molecular weight of 346.37 g/mol. Its IUPAC name is 1-methyl-4-[7-(1,1,2,2-tetrafluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine.
| Compound Name | 1-methyl-4-[7-(1,1,2,2-tetrafluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine |
|---|---|
| PubChem CID | 87924366 |
| Molecular Formula | C17H22F4N2O |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-methyl-4-[7-(1,1,2,2-tetrafluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]piperazine |
| SMILES | CN1CCN(C2CCCc3ccc(OC(F)(F)C(F)F)cc32)CC1 |
| InChI | InChI=1S/C17H22F4N2O/c1-22-7-9-23(10-8-22)15-4-2-3-12-5-6-13(11-14(12)15)24-17(20,21)16(18)19/h5-6,11,15-16H,2-4,7-10H2,1H3 |
| InChIKey | UBAFBTGERXHEMT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|