C19H36O6 — CID 87924395
2-[1,2-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexyl]acetic acid (PubChem CID 87924395) has the molecular formula C19H36O6 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-[1,2-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexyl]acetic acid.
| Compound Name | 2-[1,2-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexyl]acetic acid |
|---|---|
| PubChem CID | 87924395 |
| Molecular Formula | C19H36O6 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 2-[1,2-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexyl]acetic acid |
| SMILES | CC1CC(C)(C)C(OOC(C)(C)C)C(CC(=O)O)(OOC(C)(C)C)C1 |
| InChI | InChI=1S/C19H36O6/c1-13-10-18(8,9)15(22-23-16(2,3)4)19(11-13,12-14(20)21)25-24-17(5,6)7/h13,15H,10-12H2,1-9H3,(H,20,21) |
| InChIKey | AYHSUNRHSQLYPG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|