C26H29F6N5O3 — CID 87924500
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-1,3-dihydroimidazol-2-yl)methoxy]-3-nitrophenyl]piperidin-4-amine (PubChem CID 87924500) has the molecular formula C26H29F6N5O3 and a molecular weight of 573.54 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-1,3-dihydroimidazol-2-yl)methoxy]-3-nitrophenyl]piperidin-4-amine.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-1,3-dihydroimidazol-2-yl)methoxy]-3-nitrophenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 87924500 |
| Molecular Formula | C26H29F6N5O3 |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-methyl-1-[4-[(2-methyl-1,3-dihydroimidazol-2-yl)methoxy]-3-nitrophenyl]piperidin-4-amine |
| SMILES | CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCN(c2ccc(OCC3(C)NC=CN3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C26H29F6N5O3/c1-24(33-7-8-34-24)16-40-23-4-3-21(14-22(23)37(38)39)36-9-5-20(6-10-36)35(2)15-17-11-18(25(27,28)29)13-19(12-17)26(30,31)32/h3-4,7-8,11-14,20,33-34H,5-6,9-10,15-16H2,1-2H3 |
| InChIKey | FDXLGBRHCNDSNI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|