C26H30N2O7S — CID 87924617
[12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadecan-11-yl] N-(1-benzothiophen-3-yl)carbamate (PubChem CID 87924617) has the molecular formula C26H30N2O7S and a molecular weight of 514.60 g/mol. Its IUPAC name is [12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadecan-11-yl] N-(1-benzothiophen-3-yl)carbamate.
| Compound Name | [12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadecan-11-yl] N-(1-benzothiophen-3-yl)carbamate |
|---|---|
| PubChem CID | 87924617 |
| Molecular Formula | C26H30N2O7S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | [12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadecan-11-yl] N-(1-benzothiophen-3-yl)carbamate |
| SMILES | CC1C(=O)OC2CC3(C)OC3C(OC(=O)Nc3csc4ccccc34)C(N(C)C)C3CC(OC3=O)C21 |
| InChI | InChI=1S/C26H30N2O7S/c1-12-19-16-9-14(24(30)32-16)20(28(3)4)21(22-26(2,35-22)10-17(19)33-23(12)29)34-25(31)27-15-11-36-18-8-6-5-7-13(15)18/h5-8,11-12,14,16-17,19-22H,9-10H2,1-4H3,(H,27,31) |
| InChIKey | PTFHBVOAZOUCEV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|