About cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide
cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide (PubChem CID 87924727) has the molecular formula C21H16F2Zr
and a molecular weight of 397.58 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide |
| PubChem CID | 87924727 |
| Molecular Formula | C21H16F2Zr |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide |
| SMILES | Fc1ccc2[cH-]c3ccc(F)cc3c2c1.[C-]1=CC=CC1.[Zr+2]=C1CC1 |
| InChI | InChI=1S/C13H7F2.C5H5.C3H4.Zr/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10;1-2-4-5-3-1;1-2-3-1;/h1-7H;1-3H,4H2;1-2H2;/q2*-1;;+2 |
| InChIKey | GMWVEJGDSADHHN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide?
The IUPAC name of cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide (CID 87924727) is cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide.
What is the SMILES notation for cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide?
The canonical SMILES for cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide is Fc1ccc2[cH-]c3ccc(F)cc3c2c1.[C-]1=CC=CC1.[Zr+2]=C1CC1.
What is the InChIKey of cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide?
The InChIKey is GMWVEJGDSADHHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F2.C5H5.C3H4.Zr/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)12(8)6-10;1-2-4-5-3-1;1-2-3-1;/h1-7H;1-3H,4H2;1-2H2;/q2*-1;;+2.
What are the key properties of cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide?
cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide has a molecular weight of 397.58 g/mol, XLogP of 5.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;cyclopropylidenezirconium(2+);3,6-difluoro-9H-fluoren-9-ide is sourced from PubChem (CID 87924727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).